C18H19N — CID 142037585
3-methyl-4-[(1E,3Z)-1-phenylpenta-1,3-dien-3-yl]aniline (PubChem CID 142037585) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is 3-methyl-4-[(1E,3Z)-1-phenylpenta-1,3-dien-3-yl]aniline.
| Compound Name | 3-methyl-4-[(1E,3Z)-1-phenylpenta-1,3-dien-3-yl]aniline |
|---|---|
| PubChem CID | 142037585 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 3-methyl-4-[(1E,3Z)-1-phenylpenta-1,3-dien-3-yl]aniline |
| SMILES | C/C=C(/C=C/c1ccccc1)c1ccc(N)cc1C |
| InChI | InChI=1S/C18H19N/c1-3-16(10-9-15-7-5-4-6-8-15)18-12-11-17(19)13-14(18)2/h3-13H,19H2,1-2H3/b10-9+,16-3- |
| InChIKey | OWRAFIZLZJYZIL-HJKYPQNTSA-N |
| XLogP | 4.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|