C38H34O10S — CID 67960859
2-[(E)-3-phenylprop-2-enoyl]oxyethyl 2-methyl-4-[3-methyl-4-[2-[(E)-3-phenylprop-2-enoyl]oxyethoxycarbonyl]phenyl]sulfonylbenzoate (PubChem CID 67960859) has the molecular formula C38H34O10S and a molecular weight of 682.75 g/mol. Its IUPAC name is 2-[(E)-3-phenylprop-2-enoyl]oxyethyl 2-methyl-4-[3-methyl-4-[2-[(E)-3-phenylprop-2-enoyl]oxyethoxycarbonyl]phenyl]sulfonylbenzoate.
| Compound Name | 2-[(E)-3-phenylprop-2-enoyl]oxyethyl 2-methyl-4-[3-methyl-4-[2-[(E)-3-phenylprop-2-enoyl]oxyethoxycarbonyl]phenyl]sulfonylbenzoate |
|---|---|
| PubChem CID | 67960859 |
| Molecular Formula | C38H34O10S |
| Molecular Weight | 682.75 g/mol |
| Exact Mass | 682.19 |
| IUPAC Name | 2-[(E)-3-phenylprop-2-enoyl]oxyethyl 2-methyl-4-[3-methyl-4-[2-[(E)-3-phenylprop-2-enoyl]oxyethoxycarbonyl]phenyl]sulfonylbenzoate |
| SMILES | Cc1cc(S(=O)(=O)c2ccc(C(=O)OCCOC(=O)/C=C/c3ccccc3)c(C)c2)ccc1C(=O)OCCOC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C38H34O10S/c1-27-25-31(15-17-33(27)37(41)47-23-21-45-35(39)19-13-29-9-5-3-6-10-29)49(43,44)32-16-18-34(28(2)26-32)38(42)48-24-22-46-36(40)20-14-30-11-7-4-8-12-30/h3-20,25-26H,21-24H2,1-2H3/b19-13+,20-14+ |
| InChIKey | YYWBQHCEVBEYTK-IWGRKNQJSA-N |
| XLogP | 5.96 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.75 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|