C17H26NO2+ — CID 123772067
triethyl-[2-(3-phenylprop-2-enoyloxy)ethyl]azanium (PubChem CID 123772067) has the molecular formula C17H26NO2+ and a molecular weight of 276.40 g/mol. Its IUPAC name is triethyl-[2-(3-phenylprop-2-enoyloxy)ethyl]azanium.
| Compound Name | triethyl-[2-(3-phenylprop-2-enoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 123772067 |
| Molecular Formula | C17H26NO2+ |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | triethyl-[2-(3-phenylprop-2-enoyloxy)ethyl]azanium |
| SMILES | CC[N+](CC)(CC)CCOC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C17H26NO2/c1-4-18(5-2,6-3)14-15-20-17(19)13-12-16-10-8-7-9-11-16/h7-13H,4-6,14-15H2,1-3H3/q+1 |
| InChIKey | ZCAAGVKHJOBBLB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|