About 2-ethenylsulfanylethyl (E)-3-phenylprop-2-enoate
2-ethenylsulfanylethyl (E)-3-phenylprop-2-enoate (PubChem CID 70468065) has the molecular formula C13H14O2S
and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-ethenylsulfanylethyl (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | 2-ethenylsulfanylethyl (E)-3-phenylprop-2-enoate |
| PubChem CID | 70468065 |
| Molecular Formula | C13H14O2S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-ethenylsulfanylethyl (E)-3-phenylprop-2-enoate |
| SMILES | C=CSCCOC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H14O2S/c1-2-16-11-10-15-13(14)9-8-12-6-4-3-5-7-12/h2-9H,1,10-11H2/b9-8+ |
| InChIKey | ZUURIZYRJICESU-CMDGGOBGSA-N |
| XLogP | 3.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenylsulfanylethyl (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylsulfanylethyl (E)-3-phenylprop-2-enoate?
The IUPAC name of 2-ethenylsulfanylethyl (E)-3-phenylprop-2-enoate (CID 70468065) is 2-ethenylsulfanylethyl (E)-3-phenylprop-2-enoate.
What is the SMILES notation for 2-ethenylsulfanylethyl (E)-3-phenylprop-2-enoate?
The canonical SMILES for 2-ethenylsulfanylethyl (E)-3-phenylprop-2-enoate is C=CSCCOC(=O)/C=C/c1ccccc1.
What is the InChIKey of 2-ethenylsulfanylethyl (E)-3-phenylprop-2-enoate?
The InChIKey is ZUURIZYRJICESU-CMDGGOBGSA-N. The full InChI is InChI=1S/C13H14O2S/c1-2-16-11-10-15-13(14)9-8-12-6-4-3-5-7-12/h2-9H,1,10-11H2/b9-8+.
What are the key properties of 2-ethenylsulfanylethyl (E)-3-phenylprop-2-enoate?
2-ethenylsulfanylethyl (E)-3-phenylprop-2-enoate has a molecular weight of 234.32 g/mol, XLogP of 3.12, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylsulfanylethyl (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 70468065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).