C20H32INO3 — CID 11385668
butyl-diethyl-[2-hydroxy-3-[(E)-3-phenylprop-2-enoyl]oxypropyl]azanium iodide (PubChem CID 11385668) has the molecular formula C20H32INO3 and a molecular weight of 461.38 g/mol. Its IUPAC name is butyl-diethyl-[2-hydroxy-3-[(E)-3-phenylprop-2-enoyl]oxypropyl]azanium iodide.
| Compound Name | butyl-diethyl-[2-hydroxy-3-[(E)-3-phenylprop-2-enoyl]oxypropyl]azanium iodide |
|---|---|
| PubChem CID | 11385668 |
| Molecular Formula | C20H32INO3 |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | butyl-diethyl-[2-hydroxy-3-[(E)-3-phenylprop-2-enoyl]oxypropyl]azanium iodide |
| SMILES | CCCC[N+](CC)(CC)CC(O)COC(=O)/C=C/c1ccccc1.[I-] |
| InChI | InChI=1S/C20H32NO3.HI/c1-4-7-15-21(5-2,6-3)16-19(22)17-24-20(23)14-13-18-11-9-8-10-12-18;/h8-14,19,22H,4-7,15-17H2,1-3H3;1H/q+1;/p-1/b14-13+; |
| InChIKey | DMYKOKWCWCGRQX-IERUDJENSA-M |
| XLogP | 0.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|