C23H38NO6+ — CID 11168842
butyl-diethyl-[2-hydroxy-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]azanium (PubChem CID 11168842) has the molecular formula C23H38NO6+ and a molecular weight of 424.56 g/mol. Its IUPAC name is butyl-diethyl-[2-hydroxy-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]azanium.
| Compound Name | butyl-diethyl-[2-hydroxy-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]azanium |
|---|---|
| PubChem CID | 11168842 |
| Molecular Formula | C23H38NO6+ |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | butyl-diethyl-[2-hydroxy-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxypropyl]azanium |
| SMILES | CCCC[N+](CC)(CC)CC(O)COC(=O)/C=C/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C23H38NO6/c1-7-10-13-24(8-2,9-3)16-19(25)17-30-22(26)12-11-18-14-20(27-4)23(29-6)21(15-18)28-5/h11-12,14-15,19,25H,7-10,13,16-17H2,1-6H3/q+1/b12-11+ |
| InChIKey | PBXKFAYRKKRYNK-VAWYXSNFSA-N |
| XLogP | 3.29 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|