C18H29N3 — CID 145019347
but-2-yne;ethane;5-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-hydrazinylaniline (PubChem CID 145019347) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is but-2-yne;ethane;5-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-hydrazinylaniline.
| Compound Name | but-2-yne;ethane;5-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-hydrazinylaniline |
|---|---|
| PubChem CID | 145019347 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | but-2-yne;ethane;5-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-hydrazinylaniline |
| SMILES | C/C=C\C(=C/C)c1ccc(NN)c(N)c1.CC.CC#CC |
| InChI | InChI=1S/C12H17N3.C4H6.C2H6/c1-3-5-9(4-2)10-6-7-12(15-14)11(13)8-10;1-3-4-2;1-2/h3-8,15H,13-14H2,1-2H3;1-2H3;1-2H3/b5-3-,9-4+;; |
| InChIKey | KWGDBIAILFKNRW-ULOKQNOHSA-N |
| XLogP | 4.59 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|