C24H28N2 — CID 145407811
4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline (PubChem CID 145407811) has the molecular formula C24H28N2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline.
| Compound Name | 4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline |
|---|---|
| PubChem CID | 145407811 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline |
| SMILES | C=CNC/C(=C\C)c1ccc(Nc2ccc(C(/C=C\C)=C/C)cc2)cc1 |
| InChI | InChI=1S/C24H28N2/c1-5-9-19(6-2)21-10-14-23(15-11-21)26-24-16-12-22(13-17-24)20(7-3)18-25-8-4/h5-17,25-26H,4,18H2,1-3H3/b9-5-,19-6+,20-7+ |
| InChIKey | XACODQHIABQWEJ-FAZCKKMRSA-N |
| XLogP | 6.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|