About 4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline
4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline (PubChem CID 145407811) has the molecular formula C24H28N2
and a molecular weight of 344.50 g/mol. Its IUPAC name is 4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline.
Molecular Properties
| Compound Name | 4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline |
| PubChem CID | 145407811 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline |
| SMILES | C=CNC/C(=C\C)c1ccc(Nc2ccc(C(/C=C\C)=C/C)cc2)cc1 |
| InChI | InChI=1S/C24H28N2/c1-5-9-19(6-2)21-10-14-23(15-11-21)26-24-16-12-22(13-17-24)20(7-3)18-25-8-4/h5-17,25-26H,4,18H2,1-3H3/b9-5-,19-6+,20-7+ |
| InChIKey | XACODQHIABQWEJ-FAZCKKMRSA-N |
| XLogP | 6.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline?
The IUPAC name of 4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline (CID 145407811) is 4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline.
What is the SMILES notation for 4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline?
The canonical SMILES for 4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline is C=CNC/C(=C\C)c1ccc(Nc2ccc(C(/C=C\C)=C/C)cc2)cc1.
What is the InChIKey of 4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline?
The InChIKey is XACODQHIABQWEJ-FAZCKKMRSA-N. The full InChI is InChI=1S/C24H28N2/c1-5-9-19(6-2)21-10-14-23(15-11-21)26-24-16-12-22(13-17-24)20(7-3)18-25-8-4/h5-17,25-26H,4,18H2,1-3H3/b9-5-,19-6+,20-7+.
What are the key properties of 4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline?
4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline has a molecular weight of 344.50 g/mol, XLogP of 6.55, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-1-(ethenylamino)but-2-en-2-yl]-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]aniline is sourced from PubChem (CID 145407811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).