C25H25NS — CID 145360955
3-ethenyl-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-2-[(Z)-prop-1-enyl]-1-benzothiophen-7-amine (PubChem CID 145360955) has the molecular formula C25H25NS and a molecular weight of 371.55 g/mol. Its IUPAC name is 3-ethenyl-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-2-[(Z)-prop-1-enyl]-1-benzothiophen-7-amine.
| Compound Name | 3-ethenyl-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-2-[(Z)-prop-1-enyl]-1-benzothiophen-7-amine |
|---|---|
| PubChem CID | 145360955 |
| Molecular Formula | C25H25NS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 3-ethenyl-N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-2-[(Z)-prop-1-enyl]-1-benzothiophen-7-amine |
| SMILES | C=Cc1c(/C=C\C)sc2c(Nc3ccc(C(/C=C\C)=C/C)cc3)cccc12 |
| InChI | InChI=1S/C25H25NS/c1-5-10-18(7-3)19-14-16-20(17-15-19)26-23-13-9-12-22-21(8-4)24(11-6-2)27-25(22)23/h5-17,26H,4H2,1-3H3/b10-5-,11-6-,18-7+ |
| InChIKey | QGIASTAMHXIMFP-UHWZZASGSA-N |
| XLogP | 8.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|