C22H23NS — CID 145407652
2-ethenyl-N-phenyl-3-[(Z)-prop-1-enyl]-1-benzothiophen-6-amine;prop-1-ene (PubChem CID 145407652) has the molecular formula C22H23NS and a molecular weight of 333.50 g/mol. Its IUPAC name is 2-ethenyl-N-phenyl-3-[(Z)-prop-1-enyl]-1-benzothiophen-6-amine;prop-1-ene.
| Compound Name | 2-ethenyl-N-phenyl-3-[(Z)-prop-1-enyl]-1-benzothiophen-6-amine;prop-1-ene |
|---|---|
| PubChem CID | 145407652 |
| Molecular Formula | C22H23NS |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-ethenyl-N-phenyl-3-[(Z)-prop-1-enyl]-1-benzothiophen-6-amine;prop-1-ene |
| SMILES | C=CC.C=Cc1sc2cc(Nc3ccccc3)ccc2c1/C=C\C |
| InChI | InChI=1S/C19H17NS.C3H6/c1-3-8-16-17-12-11-15(13-19(17)21-18(16)4-2)20-14-9-6-5-7-10-14;1-3-2/h3-13,20H,2H2,1H3;3H,1H2,2H3/b8-3-; |
| InChIKey | HZCILIFMXRAVLH-NGRDVXTNSA-N |
| XLogP | 7.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|