C37H33BN2S2 — CID 153374236
CID 153374236 (PubChem CID 153374236) has the molecular formula C37H33BN2S2 and a molecular weight of 580.63 g/mol.
| Compound Name | CID 153374236 |
|---|---|
| PubChem CID | 153374236 |
| Molecular Formula | C37H33BN2S2 |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | — |
| SMILES | C=Cc1sc2cc(C(c3ccccc3)c3ccc(-c4ccc5ccccc5c4)cc3)ccc2c1/C=C\C.C=NN.[B]S |
| InChI | InChI=1S/C36H28S.CH4N2.BHS/c1-3-10-32-33-22-21-31(24-35(33)37-34(32)4-2)36(27-12-6-5-7-13-27)28-18-15-26(16-19-28)30-20-17-25-11-8-9-14-29(25)23-30;1-3-2;1-2/h3-24,36H,2H2,1H3;1-2H2;2H/b10-3-;; |
| InChIKey | ZJLPWBOSXHFTRQ-CFZKVASOSA-N |
| XLogP | 10.14 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|