About ethane;2-naphthalen-2-ylnaphthalene;bis(prop-1-ene)
ethane;2-naphthalen-2-ylnaphthalene;bis(prop-1-ene) (PubChem CID 144938631) has the molecular formula C32H44
and a molecular weight of 428.70 g/mol. Its IUPAC name is ethane;2-naphthalen-2-ylnaphthalene;bis(prop-1-ene).
Molecular Properties
| Compound Name | ethane;2-naphthalen-2-ylnaphthalene;bis(prop-1-ene) |
| PubChem CID | 144938631 |
| Molecular Formula | C32H44 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.34 |
| IUPAC Name | ethane;2-naphthalen-2-ylnaphthalene;bis(prop-1-ene) |
| SMILES | C=CC.C=CC.CC.CC.CC.c1ccc2cc(-c3ccc4ccccc4c3)ccc2c1 |
| InChI | InChI=1S/C20H14.2C3H6.3C2H6/c1-3-7-17-13-19(11-9-15(17)5-1)20-12-10-16-6-2-4-8-18(16)14-20;2*1-3-2;3*1-2/h1-14H;2*3H,1H2,2H3;3*1-2H3 |
| InChIKey | CPTNEPJENPZOAQ-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-naphthalen-2-ylnaphthalene;bis(prop-1-ene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-naphthalen-2-ylnaphthalene;bis(prop-1-ene)?
The IUPAC name of ethane;2-naphthalen-2-ylnaphthalene;bis(prop-1-ene) (CID 144938631) is ethane;2-naphthalen-2-ylnaphthalene;bis(prop-1-ene).
What is the SMILES notation for ethane;2-naphthalen-2-ylnaphthalene;bis(prop-1-ene)?
The canonical SMILES for ethane;2-naphthalen-2-ylnaphthalene;bis(prop-1-ene) is C=CC.C=CC.CC.CC.CC.c1ccc2cc(-c3ccc4ccccc4c3)ccc2c1.
What is the InChIKey of ethane;2-naphthalen-2-ylnaphthalene;bis(prop-1-ene)?
The InChIKey is CPTNEPJENPZOAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14.2C3H6.3C2H6/c1-3-7-17-13-19(11-9-15(17)5-1)20-12-10-16-6-2-4-8-18(16)14-20;2*1-3-2;3*1-2/h1-14H;2*3H,1H2,2H3;3*1-2H3.
What are the key properties of ethane;2-naphthalen-2-ylnaphthalene;bis(prop-1-ene)?
ethane;2-naphthalen-2-ylnaphthalene;bis(prop-1-ene) has a molecular weight of 428.70 g/mol, XLogP of 11.12, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-naphthalen-2-ylnaphthalene;bis(prop-1-ene) is sourced from PubChem (CID 144938631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).