About ethane;4-naphthalen-2-ylaniline;prop-1-ene
ethane;4-naphthalen-2-ylaniline;prop-1-ene (PubChem CID 145312998) has the molecular formula C21H25N
and a molecular weight of 291.44 g/mol. Its IUPAC name is ethane;4-naphthalen-2-ylaniline;prop-1-ene.
Molecular Properties
| Compound Name | ethane;4-naphthalen-2-ylaniline;prop-1-ene |
| PubChem CID | 145312998 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | ethane;4-naphthalen-2-ylaniline;prop-1-ene |
| SMILES | C=CC.CC.Nc1ccc(-c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C16H13N.C3H6.C2H6/c17-16-9-7-13(8-10-16)15-6-5-12-3-1-2-4-14(12)11-15;1-3-2;1-2/h1-11H,17H2;3H,1H2,2H3;1-2H3 |
| InChIKey | NEZUQYCITSZMDW-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-naphthalen-2-ylaniline;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-naphthalen-2-ylaniline;prop-1-ene?
The IUPAC name of ethane;4-naphthalen-2-ylaniline;prop-1-ene (CID 145312998) is ethane;4-naphthalen-2-ylaniline;prop-1-ene.
What is the SMILES notation for ethane;4-naphthalen-2-ylaniline;prop-1-ene?
The canonical SMILES for ethane;4-naphthalen-2-ylaniline;prop-1-ene is C=CC.CC.Nc1ccc(-c2ccc3ccccc3c2)cc1.
What is the InChIKey of ethane;4-naphthalen-2-ylaniline;prop-1-ene?
The InChIKey is NEZUQYCITSZMDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N.C3H6.C2H6/c17-16-9-7-13(8-10-16)15-6-5-12-3-1-2-4-14(12)11-15;1-3-2;1-2/h1-11H,17H2;3H,1H2,2H3;1-2H3.
What are the key properties of ethane;4-naphthalen-2-ylaniline;prop-1-ene?
ethane;4-naphthalen-2-ylaniline;prop-1-ene has a molecular weight of 291.44 g/mol, XLogP of 6.31, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-naphthalen-2-ylaniline;prop-1-ene is sourced from PubChem (CID 145312998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).