C20H15N — CID 165150289
4-(9,10-dideuterioanthracen-2-yl)aniline (PubChem CID 165150289) has the molecular formula C20H15N and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-(9,10-dideuterioanthracen-2-yl)aniline.
| Compound Name | 4-(9,10-dideuterioanthracen-2-yl)aniline |
|---|---|
| PubChem CID | 165150289 |
| Molecular Formula | C20H15N |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 4-(9,10-dideuterioanthracen-2-yl)aniline |
| SMILES | [2H]c1c2ccccc2c([2H])c2cc(-c3ccc(N)cc3)ccc12 |
| InChI | InChI=1S/C20H15N/c21-20-9-7-14(8-10-20)17-5-6-18-11-15-3-1-2-4-16(15)12-19(18)13-17/h1-13H,21H2/i11D,12D |
| InChIKey | VUVMBASZGWDZMW-USUSYXOVSA-N |
| XLogP | 5.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|