C21H20N2S — CID 145407808
N-(4-methylphenyl)-[1]benzothiolo[2,3-b]pyridin-7-amine;prop-1-ene (PubChem CID 145407808) has the molecular formula C21H20N2S and a molecular weight of 332.47 g/mol. Its IUPAC name is N-(4-methylphenyl)-[1]benzothiolo[2,3-b]pyridin-7-amine;prop-1-ene.
| Compound Name | N-(4-methylphenyl)-[1]benzothiolo[2,3-b]pyridin-7-amine;prop-1-ene |
|---|---|
| PubChem CID | 145407808 |
| Molecular Formula | C21H20N2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-(4-methylphenyl)-[1]benzothiolo[2,3-b]pyridin-7-amine;prop-1-ene |
| SMILES | C=CC.Cc1ccc(Nc2ccc3c(c2)sc2ncccc23)cc1 |
| InChI | InChI=1S/C18H14N2S.C3H6/c1-12-4-6-13(7-5-12)20-14-8-9-15-16-3-2-10-19-18(16)21-17(15)11-14;1-3-2/h2-11,20H,1H3;3H,1H2,2H3 |
| InChIKey | YEAQYKZNARLFTI-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|