C24H19NS — CID 144963579
N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]dibenzothiophen-3-amine (PubChem CID 144963579) has the molecular formula C24H19NS and a molecular weight of 353.49 g/mol. Its IUPAC name is N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]dibenzothiophen-3-amine.
| Compound Name | N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]dibenzothiophen-3-amine |
|---|---|
| PubChem CID | 144963579 |
| Molecular Formula | C24H19NS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]dibenzothiophen-3-amine |
| SMILES | C=C/C=C(\C=C)c1ccc(Nc2ccc3c(c2)sc2ccccc23)cc1 |
| InChI | InChI=1S/C24H19NS/c1-3-7-17(4-2)18-10-12-19(13-11-18)25-20-14-15-22-21-8-5-6-9-23(21)26-24(22)16-20/h3-16,25H,1-2H2/b17-7+ |
| InChIKey | NQEZHEWMHBEENZ-REZTVBANSA-N |
| XLogP | 7.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|