C22H16N2 — CID 143847567
10-[(3E)-hexa-1,3,5-trien-3-yl]phenanthro[9,10-b]pyrazine (PubChem CID 143847567) has the molecular formula C22H16N2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 10-[(3E)-hexa-1,3,5-trien-3-yl]phenanthro[9,10-b]pyrazine.
| Compound Name | 10-[(3E)-hexa-1,3,5-trien-3-yl]phenanthro[9,10-b]pyrazine |
|---|---|
| PubChem CID | 143847567 |
| Molecular Formula | C22H16N2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 10-[(3E)-hexa-1,3,5-trien-3-yl]phenanthro[9,10-b]pyrazine |
| SMILES | C=C/C=C(\C=C)c1ccc2c(c1)c1ccccc1c1nccnc21 |
| InChI | InChI=1S/C22H16N2/c1-3-7-15(4-2)16-10-11-19-20(14-16)17-8-5-6-9-18(17)21-22(19)24-13-12-23-21/h3-14H,1-2H2/b15-7+ |
| InChIKey | HNLIZKXCIBPFMW-VIZOYTHASA-N |
| XLogP | 5.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|