C16H9ClN2 — CID 121296750
10-chlorophenanthro[9,10-b]pyrazine (PubChem CID 121296750) has the molecular formula C16H9ClN2 and a molecular weight of 264.72 g/mol. Its IUPAC name is 10-chlorophenanthro[9,10-b]pyrazine.
| Compound Name | 10-chlorophenanthro[9,10-b]pyrazine |
|---|---|
| PubChem CID | 121296750 |
| Molecular Formula | C16H9ClN2 |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 10-chlorophenanthro[9,10-b]pyrazine |
| SMILES | Clc1ccc2c(c1)c1ccccc1c1nccnc21 |
| InChI | InChI=1S/C16H9ClN2/c17-10-5-6-13-14(9-10)11-3-1-2-4-12(11)15-16(13)19-8-7-18-15/h1-9H |
| InChIKey | JFGCEGJPNRBSDD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|