About 10-chlorophenanthro[9,10-b]pyrazine
10-chlorophenanthro[9,10-b]pyrazine (PubChem CID 121296750) has the molecular formula C16H9ClN2
and a molecular weight of 264.72 g/mol. Its IUPAC name is 10-chlorophenanthro[9,10-b]pyrazine.
Molecular Properties
| Compound Name | 10-chlorophenanthro[9,10-b]pyrazine |
| PubChem CID | 121296750 |
| Molecular Formula | C16H9ClN2 |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 10-chlorophenanthro[9,10-b]pyrazine |
| SMILES | Clc1ccc2c(c1)c1ccccc1c1nccnc21 |
| InChI | InChI=1S/C16H9ClN2/c17-10-5-6-13-14(9-10)11-3-1-2-4-12(11)15-16(13)19-8-7-18-15/h1-9H |
| InChIKey | JFGCEGJPNRBSDD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 10-chlorophenanthro[9,10-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-chlorophenanthro[9,10-b]pyrazine?
The IUPAC name of 10-chlorophenanthro[9,10-b]pyrazine (CID 121296750) is 10-chlorophenanthro[9,10-b]pyrazine.
What is the SMILES notation for 10-chlorophenanthro[9,10-b]pyrazine?
The canonical SMILES for 10-chlorophenanthro[9,10-b]pyrazine is Clc1ccc2c(c1)c1ccccc1c1nccnc21.
What is the InChIKey of 10-chlorophenanthro[9,10-b]pyrazine?
The InChIKey is JFGCEGJPNRBSDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9ClN2/c17-10-5-6-13-14(9-10)11-3-1-2-4-12(11)15-16(13)19-8-7-18-15/h1-9H.
What are the key properties of 10-chlorophenanthro[9,10-b]pyrazine?
10-chlorophenanthro[9,10-b]pyrazine has a molecular weight of 264.72 g/mol, XLogP of 4.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-chlorophenanthro[9,10-b]pyrazine is sourced from PubChem (CID 121296750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).