About naphtho[2,1-f]quinoxalin-12-ol
naphtho[2,1-f]quinoxalin-12-ol (PubChem CID 174684520) has the molecular formula C16H10N2O
and a molecular weight of 246.27 g/mol. Its IUPAC name is naphtho[2,1-f]quinoxalin-12-ol.
Molecular Properties
| Compound Name | naphtho[2,1-f]quinoxalin-12-ol |
| PubChem CID | 174684520 |
| Molecular Formula | C16H10N2O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | naphtho[2,1-f]quinoxalin-12-ol |
| SMILES | Oc1cc2c3ccccc3ccc2c2nccnc12 |
| InChI | InChI=1S/C16H10N2O/c19-14-9-13-11-4-2-1-3-10(11)5-6-12(13)15-16(14)18-8-7-17-15/h1-9,19H |
| InChIKey | ZSCYCDRZVHANCQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze naphtho[2,1-f]quinoxalin-12-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphtho[2,1-f]quinoxalin-12-ol?
The IUPAC name of naphtho[2,1-f]quinoxalin-12-ol (CID 174684520) is naphtho[2,1-f]quinoxalin-12-ol.
What is the SMILES notation for naphtho[2,1-f]quinoxalin-12-ol?
The canonical SMILES for naphtho[2,1-f]quinoxalin-12-ol is Oc1cc2c3ccccc3ccc2c2nccnc12.
What is the InChIKey of naphtho[2,1-f]quinoxalin-12-ol?
The InChIKey is ZSCYCDRZVHANCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O/c19-14-9-13-11-4-2-1-3-10(11)5-6-12(13)15-16(14)18-8-7-17-15/h1-9,19H.
What are the key properties of naphtho[2,1-f]quinoxalin-12-ol?
naphtho[2,1-f]quinoxalin-12-ol has a molecular weight of 246.27 g/mol, XLogP of 3.64, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphtho[2,1-f]quinoxalin-12-ol is sourced from PubChem (CID 174684520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).