C12H13Cl2N — CID 163770557
3,5-dichloro-4-[(2E,4Z)-hexa-2,4-dien-3-yl]aniline (PubChem CID 163770557) has the molecular formula C12H13Cl2N and a molecular weight of 242.15 g/mol. Its IUPAC name is 3,5-dichloro-4-[(2E,4Z)-hexa-2,4-dien-3-yl]aniline.
| Compound Name | 3,5-dichloro-4-[(2E,4Z)-hexa-2,4-dien-3-yl]aniline |
|---|---|
| PubChem CID | 163770557 |
| Molecular Formula | C12H13Cl2N |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 3,5-dichloro-4-[(2E,4Z)-hexa-2,4-dien-3-yl]aniline |
| SMILES | C/C=C\C(=C/C)c1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C12H13Cl2N/c1-3-5-8(4-2)12-10(13)6-9(15)7-11(12)14/h3-7H,15H2,1-2H3/b5-3-,8-4+ |
| InChIKey | MGAUSPXEZNQHEZ-VOGDQUTBSA-N |
| XLogP | 4.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|