C15H18ClN — CID 144540020
3-chloro-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N,5-dimethylaniline (PubChem CID 144540020) has the molecular formula C15H18ClN and a molecular weight of 247.77 g/mol. Its IUPAC name is 3-chloro-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N,5-dimethylaniline.
| Compound Name | 3-chloro-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N,5-dimethylaniline |
|---|---|
| PubChem CID | 144540020 |
| Molecular Formula | C15H18ClN |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3-chloro-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N,5-dimethylaniline |
| SMILES | C=C/C=C(\C=C/C)c1c(C)cc(NC)cc1Cl |
| InChI | InChI=1S/C15H18ClN/c1-5-7-12(8-6-2)15-11(3)9-13(17-4)10-14(15)16/h5-10,17H,1H2,2-4H3/b8-6-,12-7+ |
| InChIKey | AXVFKDVLZQUJNV-LQNKLOEDSA-N |
| XLogP | 4.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|