C20H31N2S+ — CID 153346752
ethane;2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3,6-dimethyl-1,3-benzothiazol-3-ium;N-methylmethanamine (PubChem CID 153346752) has the molecular formula C20H31N2S+ and a molecular weight of 331.55 g/mol. Its IUPAC name is ethane;2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3,6-dimethyl-1,3-benzothiazol-3-ium;N-methylmethanamine.
| Compound Name | ethane;2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3,6-dimethyl-1,3-benzothiazol-3-ium;N-methylmethanamine |
|---|---|
| PubChem CID | 153346752 |
| Molecular Formula | C20H31N2S+ |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | ethane;2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3,6-dimethyl-1,3-benzothiazol-3-ium;N-methylmethanamine |
| SMILES | C=C/C=C(\C=C/C)c1sc2cc(C)ccc2[n+]1C.CC.CNC |
| InChI | InChI=1S/C16H18NS.C2H7N.C2H6/c1-5-7-13(8-6-2)16-17(4)14-10-9-12(3)11-15(14)18-16;1-3-2;1-2/h5-11H,1H2,2-4H3;3H,1-2H3;1-2H3/q+1;;/b8-6-,13-7+;; |
| InChIKey | QMSILHNDAGUFIO-MKWZZQCTSA-N |
| XLogP | 5.04 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|