C16H21NO — CID 170956162
2-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-2-(methylamino)ethanol (PubChem CID 170956162) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-2-(methylamino)ethanol.
| Compound Name | 2-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 170956162 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 2-[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-2-(methylamino)ethanol |
| SMILES | C=C/C=C(\C=C/C)c1ccc(C(CO)NC)cc1 |
| InChI | InChI=1S/C16H21NO/c1-4-6-13(7-5-2)14-8-10-15(11-9-14)16(12-18)17-3/h4-11,16-18H,1,12H2,2-3H3/b7-5-,13-6+ |
| InChIKey | NATMXGDGSNSWMN-IILXRZLBSA-N |
| XLogP | 3.08 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|