C17H24N+ — CID 166774716
4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-pentylpyridin-1-ium (PubChem CID 166774716) has the molecular formula C17H24N+ and a molecular weight of 242.39 g/mol. Its IUPAC name is 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-pentylpyridin-1-ium.
| Compound Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-pentylpyridin-1-ium |
|---|---|
| PubChem CID | 166774716 |
| Molecular Formula | C17H24N+ |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-pentylpyridin-1-ium |
| SMILES | C=C/C=C(\C=C/C)c1cc[n+](CCCCC)cc1 |
| InChI | InChI=1S/C17H24N/c1-4-7-8-13-18-14-11-17(12-15-18)16(9-5-2)10-6-3/h5-6,9-12,14-15H,2,4,7-8,13H2,1,3H3/q+1/b10-6-,16-9+ |
| InChIKey | KAEGBKAFZGDXLW-GQAHHDQSSA-N |
| XLogP | 4.31 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|