C17H21NO — CID 142960008
4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-propylbenzamide (PubChem CID 142960008) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-propylbenzamide.
| Compound Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-propylbenzamide |
|---|---|
| PubChem CID | 142960008 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-N-propylbenzamide |
| SMILES | C=C/C=C(\C=C/C)c1ccc(C(=O)NCCC)cc1 |
| InChI | InChI=1S/C17H21NO/c1-4-7-14(8-5-2)15-9-11-16(12-10-15)17(19)18-13-6-3/h4-5,7-12H,1,6,13H2,2-3H3,(H,18,19)/b8-5-,14-7+ |
| InChIKey | KTZXMUPFBCKXTC-FWODXUKCSA-N |
| XLogP | 3.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|