C14H17N — CID 118425061
(1Z,3E)-3-(4-ethylphenyl)hexa-1,3,5-trien-1-amine (PubChem CID 118425061) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is (1Z,3E)-3-(4-ethylphenyl)hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-3-(4-ethylphenyl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 118425061 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (1Z,3E)-3-(4-ethylphenyl)hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C/N)c1ccc(CC)cc1 |
| InChI | InChI=1S/C14H17N/c1-3-5-13(10-11-15)14-8-6-12(4-2)7-9-14/h3,5-11H,1,4,15H2,2H3/b11-10-,13-5+ |
| InChIKey | VISXLMSAXFSEMN-RUOUNYFASA-N |
| XLogP | 3.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|