About ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile
ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile (PubChem CID 142997933) has the molecular formula C18H23N
and a molecular weight of 253.39 g/mol. Its IUPAC name is ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile.
Molecular Properties
| Compound Name | ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile |
| PubChem CID | 142997933 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile |
| SMILES | C=C/C=C(C#N)\C(=C/C)c1ccc(CC)cc1.CC |
| InChI | InChI=1S/C16H17N.C2H6/c1-4-7-15(12-17)16(6-3)14-10-8-13(5-2)9-11-14;1-2/h4,6-11H,1,5H2,2-3H3;1-2H3/b15-7-,16-6-; |
| InChIKey | IQDFRKWCWIFTBG-XMFWNGHDSA-N |
| XLogP | 5.31 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile?
The IUPAC name of ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile (CID 142997933) is ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile.
What is the SMILES notation for ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile?
The canonical SMILES for ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile is C=C/C=C(C#N)\C(=C/C)c1ccc(CC)cc1.CC.
What is the InChIKey of ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile?
The InChIKey is IQDFRKWCWIFTBG-XMFWNGHDSA-N. The full InChI is InChI=1S/C16H17N.C2H6/c1-4-7-15(12-17)16(6-3)14-10-8-13(5-2)9-11-14;1-2/h4,6-11H,1,5H2,2-3H3;1-2H3/b15-7-,16-6-;.
What are the key properties of ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile?
ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile has a molecular weight of 253.39 g/mol, XLogP of 5.31, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile is sourced from PubChem (CID 142997933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).