C18H23N — CID 142997933
ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile (PubChem CID 142997933) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile.
| Compound Name | ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 142997933 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | ethane;(2E)-2-[(Z)-1-(4-ethylphenyl)prop-1-enyl]penta-2,4-dienenitrile |
| SMILES | C=C/C=C(C#N)\C(=C/C)c1ccc(CC)cc1.CC |
| InChI | InChI=1S/C16H17N.C2H6/c1-4-7-15(12-17)16(6-3)14-10-8-13(5-2)9-11-14;1-2/h4,6-11H,1,5H2,2-3H3;1-2H3/b15-7-,16-6-; |
| InChIKey | IQDFRKWCWIFTBG-XMFWNGHDSA-N |
| XLogP | 5.31 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|