C16H18N2 — CID 142468268
(2E,3E)-3-(4-ethylanilino)-2-ethylidenehexa-3,5-dienenitrile (PubChem CID 142468268) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (2E,3E)-3-(4-ethylanilino)-2-ethylidenehexa-3,5-dienenitrile.
| Compound Name | (2E,3E)-3-(4-ethylanilino)-2-ethylidenehexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 142468268 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (2E,3E)-3-(4-ethylanilino)-2-ethylidenehexa-3,5-dienenitrile |
| SMILES | C=C/C=C(Nc1ccc(CC)cc1)\C(C#N)=C/C |
| InChI | InChI=1S/C16H18N2/c1-4-7-16(14(6-3)12-17)18-15-10-8-13(5-2)9-11-15/h4,6-11,18H,1,5H2,2-3H3/b14-6-,16-7+ |
| InChIKey | RQCWRKRYQQIBKN-UNACTLIJSA-N |
| XLogP | 4.20 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|