C9H11N — CID 123756126
2-but-1-en-2-ylpenta-2,4-dienenitrile (PubChem CID 123756126) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is 2-but-1-en-2-ylpenta-2,4-dienenitrile.
| Compound Name | 2-but-1-en-2-ylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 123756126 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 2-but-1-en-2-ylpenta-2,4-dienenitrile |
| SMILES | C=CC=C(C#N)C(=C)CC |
| InChI | InChI=1S/C9H11N/c1-4-6-9(7-10)8(3)5-2/h4,6H,1,3,5H2,2H3 |
| InChIKey | SMLCJTJEGWDWFL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|