About tert-butyl 2-cyanopenta-2,4-dienoate
tert-butyl 2-cyanopenta-2,4-dienoate (PubChem CID 57006848) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is tert-butyl 2-cyanopenta-2,4-dienoate.
Molecular Properties
| Compound Name | tert-butyl 2-cyanopenta-2,4-dienoate |
| PubChem CID | 57006848 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | tert-butyl 2-cyanopenta-2,4-dienoate |
| SMILES | C=CC=C(C#N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H13NO2/c1-5-6-8(7-11)9(12)13-10(2,3)4/h5-6H,1H2,2-4H3 |
| InChIKey | KXEVQHVFMNOVDL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-cyanopenta-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-cyanopenta-2,4-dienoate?
The IUPAC name of tert-butyl 2-cyanopenta-2,4-dienoate (CID 57006848) is tert-butyl 2-cyanopenta-2,4-dienoate.
What is the SMILES notation for tert-butyl 2-cyanopenta-2,4-dienoate?
The canonical SMILES for tert-butyl 2-cyanopenta-2,4-dienoate is C=CC=C(C#N)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-cyanopenta-2,4-dienoate?
The InChIKey is KXEVQHVFMNOVDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-5-6-8(7-11)9(12)13-10(2,3)4/h5-6H,1H2,2-4H3.
What are the key properties of tert-butyl 2-cyanopenta-2,4-dienoate?
tert-butyl 2-cyanopenta-2,4-dienoate has a molecular weight of 179.22 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-cyanopenta-2,4-dienoate is sourced from PubChem (CID 57006848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).