About 5-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]pyridine
5-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]pyridine (PubChem CID 177047395) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is 5-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]pyridine.
Molecular Properties
| Compound Name | 5-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]pyridine |
| PubChem CID | 177047395 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 5-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]pyridine |
| SMILES | C=C/C=C(\C=C)c1ccc(CC)cn1 |
| InChI | InChI=1S/C13H15N/c1-4-7-12(6-3)13-9-8-11(5-2)10-14-13/h4,6-10H,1,3,5H2,2H3/b12-7+ |
| InChIKey | FCECMKXMAWXJPK-KPKJPENVSA-N |
| XLogP | 3.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]pyridine?
The IUPAC name of 5-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]pyridine (CID 177047395) is 5-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]pyridine.
What is the SMILES notation for 5-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]pyridine?
The canonical SMILES for 5-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]pyridine is C=C/C=C(\C=C)c1ccc(CC)cn1.
What is the InChIKey of 5-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]pyridine?
The InChIKey is FCECMKXMAWXJPK-KPKJPENVSA-N. The full InChI is InChI=1S/C13H15N/c1-4-7-12(6-3)13-9-8-11(5-2)10-14-13/h4,6-10H,1,3,5H2,2H3/b12-7+.
What are the key properties of 5-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]pyridine?
5-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]pyridine has a molecular weight of 185.27 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]pyridine is sourced from PubChem (CID 177047395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).