C16H25N — CID 142353727
ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine (PubChem CID 142353727) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine.
| Compound Name | ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine |
|---|---|
| PubChem CID | 142353727 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-5-methylpyridine |
| SMILES | C=C/C=C(\C=C)c1ccc(C)cn1.CC.CC |
| InChI | InChI=1S/C12H13N.2C2H6/c1-4-6-11(5-2)12-8-7-10(3)9-13-12;2*1-2/h4-9H,1-2H2,3H3;2*1-2H3/b11-6+;; |
| InChIKey | YKBREZVYLIPHOJ-QVLKBJGCSA-N |
| XLogP | 5.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|