C14H20N2 — CID 153344116
ethane;2-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidine (PubChem CID 153344116) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is ethane;2-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidine.
| Compound Name | ethane;2-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidine |
|---|---|
| PubChem CID | 153344116 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | ethane;2-ethyl-4-[(3E)-hexa-1,3,5-trien-3-yl]pyrimidine |
| SMILES | C=C/C=C(\C=C)c1ccnc(CC)n1.CC |
| InChI | InChI=1S/C12H14N2.C2H6/c1-4-7-10(5-2)11-8-9-13-12(6-3)14-11;1-2/h4-5,7-9H,1-2,6H2,3H3;1-2H3/b10-7+; |
| InChIKey | HIFGNKGOFLWHJY-HCUGZAAXSA-N |
| XLogP | 3.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|