C17H18N2 — CID 144902542
4-[(3E)-hexa-1,3-dien-3-yl]-2-(4-methylphenyl)pyrimidine (PubChem CID 144902542) has the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-[(3E)-hexa-1,3-dien-3-yl]-2-(4-methylphenyl)pyrimidine.
| Compound Name | 4-[(3E)-hexa-1,3-dien-3-yl]-2-(4-methylphenyl)pyrimidine |
|---|---|
| PubChem CID | 144902542 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 4-[(3E)-hexa-1,3-dien-3-yl]-2-(4-methylphenyl)pyrimidine |
| SMILES | C=C/C(=C\CC)c1ccnc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C17H18N2/c1-4-6-14(5-2)16-11-12-18-17(19-16)15-9-7-13(3)8-10-15/h5-12H,2,4H2,1,3H3/b14-6+ |
| InChIKey | WEWKPTGEUULARY-MKMNVTDBSA-N |
| XLogP | 4.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|