C10H8ClN3 — CID 130058312
2-chloro-4-(4-methylphenyl)-1,3,5-triazine (PubChem CID 130058312) has the molecular formula C10H8ClN3 and a molecular weight of 205.65 g/mol. Its IUPAC name is 2-chloro-4-(4-methylphenyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-(4-methylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 130058312 |
| Molecular Formula | C10H8ClN3 |
| Molecular Weight | 205.65 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 2-chloro-4-(4-methylphenyl)-1,3,5-triazine |
| SMILES | Cc1ccc(-c2ncnc(Cl)n2)cc1 |
| InChI | InChI=1S/C10H8ClN3/c1-7-2-4-8(5-3-7)9-12-6-13-10(11)14-9/h2-6H,1H3 |
| InChIKey | RRRZLYJBNVNSRL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.65 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |