C16H15N3 — CID 174359338
4-[(3E)-hexa-1,3,5-trien-3-yl]-N-phenylpyrimidin-2-amine (PubChem CID 174359338) has the molecular formula C16H15N3 and a molecular weight of 249.32 g/mol. Its IUPAC name is 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-phenylpyrimidin-2-amine.
| Compound Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 174359338 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-phenylpyrimidin-2-amine |
| SMILES | C=C/C=C(\C=C)c1ccnc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C16H15N3/c1-3-8-13(4-2)15-11-12-17-16(19-15)18-14-9-6-5-7-10-14/h3-12H,1-2H2,(H,17,18,19)/b13-8+ |
| InChIKey | HBTZDNXNPAUGPT-MDWZMJQESA-N |
| XLogP | 3.98 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|