C12H14N4 — CID 142946332
4-[(1Z)-1-aminobuta-1,3-dienyl]-N-buta-1,3-dien-2-ylpyrimidin-2-amine (PubChem CID 142946332) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 4-[(1Z)-1-aminobuta-1,3-dienyl]-N-buta-1,3-dien-2-ylpyrimidin-2-amine.
| Compound Name | 4-[(1Z)-1-aminobuta-1,3-dienyl]-N-buta-1,3-dien-2-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 142946332 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 4-[(1Z)-1-aminobuta-1,3-dienyl]-N-buta-1,3-dien-2-ylpyrimidin-2-amine |
| SMILES | C=C/C=C(\N)c1ccnc(NC(=C)C=C)n1 |
| InChI | InChI=1S/C12H14N4/c1-4-6-10(13)11-7-8-14-12(16-11)15-9(3)5-2/h4-8H,1-3,13H2,(H,14,15,16)/b10-6- |
| InChIKey | FZWQMTLHNQDAHG-POHAHGRESA-N |
| XLogP | 2.07 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|