C11H12N2 — CID 134350526
(1E)-1-(4-ethenyl-3-pyridinyl)buta-1,3-dien-1-amine (PubChem CID 134350526) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is (1E)-1-(4-ethenyl-3-pyridinyl)buta-1,3-dien-1-amine.
| Compound Name | (1E)-1-(4-ethenyl-3-pyridinyl)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 134350526 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (1E)-1-(4-ethenyl-3-pyridinyl)buta-1,3-dien-1-amine |
| SMILES | C=C/C=C(/N)c1cnccc1C=C |
| InChI | InChI=1S/C11H12N2/c1-3-5-11(12)10-8-13-7-6-9(10)4-2/h3-8H,1-2,12H2/b11-5+ |
| InChIKey | XHXFGIMGWQLWOT-VZUCSPMQSA-N |
| XLogP | 2.21 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|