C14H17N3 — CID 126499757
(2E,4Z)-N'-(3-ethenyl-4-pyridinyl)-2-methylhexa-2,4-dienimidamide (PubChem CID 126499757) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is (2E,4Z)-N'-(3-ethenyl-4-pyridinyl)-2-methylhexa-2,4-dienimidamide.
| Compound Name | (2E,4Z)-N'-(3-ethenyl-4-pyridinyl)-2-methylhexa-2,4-dienimidamide |
|---|---|
| PubChem CID | 126499757 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | (2E,4Z)-N'-(3-ethenyl-4-pyridinyl)-2-methylhexa-2,4-dienimidamide |
| SMILES | C=Cc1cnccc1/N=C(N)/C(C)=C/C=C\C |
| InChI | InChI=1S/C14H17N3/c1-4-6-7-11(3)14(15)17-13-8-9-16-10-12(13)5-2/h4-10H,2H2,1,3H3,(H2,15,16,17)/b6-4-,11-7+ |
| InChIKey | VOEXHUZVDIWYEC-WXVRQDIQSA-N |
| XLogP | 3.24 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|