About 3-bromopyridin-4-amine;prop-1-ene
3-bromopyridin-4-amine;prop-1-ene (PubChem CID 67817443) has the molecular formula C8H11BrN2
and a molecular weight of 215.09 g/mol. Its IUPAC name is 3-bromopyridin-4-amine;prop-1-ene.
Molecular Properties
| Compound Name | 3-bromopyridin-4-amine;prop-1-ene |
| PubChem CID | 67817443 |
| Molecular Formula | C8H11BrN2 |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 3-bromopyridin-4-amine;prop-1-ene |
| SMILES | C=CC.Nc1ccncc1Br |
| InChI | InChI=1S/C5H5BrN2.C3H6/c6-4-3-8-2-1-5(4)7;1-3-2/h1-3H,(H2,7,8);3H,1H2,2H3 |
| InChIKey | ITGLMNJBGWRTNJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-bromopyridin-4-amine;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopyridin-4-amine;prop-1-ene?
The IUPAC name of 3-bromopyridin-4-amine;prop-1-ene (CID 67817443) is 3-bromopyridin-4-amine;prop-1-ene.
What is the SMILES notation for 3-bromopyridin-4-amine;prop-1-ene?
The canonical SMILES for 3-bromopyridin-4-amine;prop-1-ene is C=CC.Nc1ccncc1Br.
What is the InChIKey of 3-bromopyridin-4-amine;prop-1-ene?
The InChIKey is ITGLMNJBGWRTNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5BrN2.C3H6/c6-4-3-8-2-1-5(4)7;1-3-2/h1-3H,(H2,7,8);3H,1H2,2H3.
What are the key properties of 3-bromopyridin-4-amine;prop-1-ene?
3-bromopyridin-4-amine;prop-1-ene has a molecular weight of 215.09 g/mol, XLogP of 2.62, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopyridin-4-amine;prop-1-ene is sourced from PubChem (CID 67817443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).