C7H15N3 — CID 143900144
ethane;molecular hydrogen;pyridine-3,4-diamine (PubChem CID 143900144) has the molecular formula C7H15N3 and a molecular weight of 141.22 g/mol. Its IUPAC name is ethane;molecular hydrogen;pyridine-3,4-diamine.
| Compound Name | ethane;molecular hydrogen;pyridine-3,4-diamine |
|---|---|
| PubChem CID | 143900144 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | ethane;molecular hydrogen;pyridine-3,4-diamine |
| SMILES | CC.Nc1ccncc1N.[H][H] |
| InChI | InChI=1S/C5H7N3.C2H6.H2/c6-4-1-2-8-3-5(4)7;1-2;/h1-3H,7H2,(H2,6,8);1-2H3;1H |
| InChIKey | BHYDJEXMAVFWAB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |