About 4-aminopyridin-3-ol;dihydrochloride
4-aminopyridin-3-ol;dihydrochloride (PubChem CID 127255436) has the molecular formula C5H8Cl2N2O
and a molecular weight of 183.04 g/mol. Its IUPAC name is 4-aminopyridin-3-ol;dihydrochloride.
Molecular Properties
| Compound Name | 4-aminopyridin-3-ol;dihydrochloride |
| PubChem CID | 127255436 |
| Molecular Formula | C5H8Cl2N2O |
| Molecular Weight | 183.04 g/mol |
| Exact Mass | 182.00 |
| IUPAC Name | 4-aminopyridin-3-ol;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccncc1O |
| InChI | InChI=1S/C5H6N2O.2ClH/c6-4-1-2-7-3-5(4)8;;/h1-3,8H,(H2,6,7);2*1H |
| InChIKey | IMMJEWSHPROHBK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.04 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-aminopyridin-3-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminopyridin-3-ol;dihydrochloride?
The IUPAC name of 4-aminopyridin-3-ol;dihydrochloride (CID 127255436) is 4-aminopyridin-3-ol;dihydrochloride.
What is the SMILES notation for 4-aminopyridin-3-ol;dihydrochloride?
The canonical SMILES for 4-aminopyridin-3-ol;dihydrochloride is Cl.Cl.Nc1ccncc1O.
What is the InChIKey of 4-aminopyridin-3-ol;dihydrochloride?
The InChIKey is IMMJEWSHPROHBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O.2ClH/c6-4-1-2-7-3-5(4)8;;/h1-3,8H,(H2,6,7);2*1H.
What are the key properties of 4-aminopyridin-3-ol;dihydrochloride?
4-aminopyridin-3-ol;dihydrochloride has a molecular weight of 183.04 g/mol, XLogP of 1.21, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminopyridin-3-ol;dihydrochloride is sourced from PubChem (CID 127255436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).