About 4-methylpyridin-3-ol;trihydrobromide
4-methylpyridin-3-ol;trihydrobromide (PubChem CID 174838364) has the molecular formula C6H10Br3NO
and a molecular weight of 351.86 g/mol. Its IUPAC name is 4-methylpyridin-3-ol;trihydrobromide.
Molecular Properties
| Compound Name | 4-methylpyridin-3-ol;trihydrobromide |
| PubChem CID | 174838364 |
| Molecular Formula | C6H10Br3NO |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 348.83 |
| IUPAC Name | 4-methylpyridin-3-ol;trihydrobromide |
| SMILES | Br.Br.Br.Cc1ccncc1O |
| InChI | InChI=1S/C6H7NO.3BrH/c1-5-2-3-7-4-6(5)8;;;/h2-4,8H,1H3;3*1H |
| InChIKey | USGWHLKOQVFSID-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylpyridin-3-ol;trihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpyridin-3-ol;trihydrobromide?
The IUPAC name of 4-methylpyridin-3-ol;trihydrobromide (CID 174838364) is 4-methylpyridin-3-ol;trihydrobromide.
What is the SMILES notation for 4-methylpyridin-3-ol;trihydrobromide?
The canonical SMILES for 4-methylpyridin-3-ol;trihydrobromide is Br.Br.Br.Cc1ccncc1O.
What is the InChIKey of 4-methylpyridin-3-ol;trihydrobromide?
The InChIKey is USGWHLKOQVFSID-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO.3BrH/c1-5-2-3-7-4-6(5)8;;;/h2-4,8H,1H3;3*1H.
What are the key properties of 4-methylpyridin-3-ol;trihydrobromide?
4-methylpyridin-3-ol;trihydrobromide has a molecular weight of 351.86 g/mol, XLogP of 2.83, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpyridin-3-ol;trihydrobromide is sourced from PubChem (CID 174838364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).