C15H19N — CID 158871716
3,4-dimethylpyridine;1,2-xylene (PubChem CID 158871716) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 3,4-dimethylpyridine;1,2-xylene.
| Compound Name | 3,4-dimethylpyridine;1,2-xylene |
|---|---|
| PubChem CID | 158871716 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 3,4-dimethylpyridine;1,2-xylene |
| SMILES | Cc1ccccc1C.Cc1ccncc1C |
| InChI | InChI=1S/C8H10.C7H9N/c1-7-5-3-4-6-8(7)2;1-6-3-4-8-5-7(6)2/h3-6H,1-2H3;3-5H,1-2H3 |
| InChIKey | JBXSAPBOCOMFJE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |