C25H43N5 — CID 158803721
3,4-dimethylpyridine;bis(4,5-dimethylpyrimidine);ethane (PubChem CID 158803721) has the molecular formula C25H43N5 and a molecular weight of 413.65 g/mol. Its IUPAC name is 3,4-dimethylpyridine;bis(4,5-dimethylpyrimidine);ethane.
| Compound Name | 3,4-dimethylpyridine;bis(4,5-dimethylpyrimidine);ethane |
|---|---|
| PubChem CID | 158803721 |
| Molecular Formula | C25H43N5 |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.35 |
| IUPAC Name | 3,4-dimethylpyridine;bis(4,5-dimethylpyrimidine);ethane |
| SMILES | CC.CC.CC.Cc1ccncc1C.Cc1cncnc1C.Cc1cncnc1C |
| InChI | InChI=1S/C7H9N.2C6H8N2.3C2H6/c1-6-3-4-8-5-7(6)2;2*1-5-3-7-4-8-6(5)2;3*1-2/h3-5H,1-2H3;2*3-4H,1-2H3;3*1-2H3 |
| InChIKey | ITURHCVEXKMCCV-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |