C6H9ClN2 — CID 126810746
4,5-dimethylpyrimidine;hydrochloride (PubChem CID 126810746) has the molecular formula C6H9ClN2 and a molecular weight of 144.61 g/mol. Its IUPAC name is 4,5-dimethylpyrimidine;hydrochloride.
| Compound Name | 4,5-dimethylpyrimidine;hydrochloride |
|---|---|
| PubChem CID | 126810746 |
| Molecular Formula | C6H9ClN2 |
| Molecular Weight | 144.61 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 4,5-dimethylpyrimidine;hydrochloride |
| SMILES | Cc1cncnc1C.Cl |
| InChI | InChI=1S/C6H8N2.ClH/c1-5-3-7-4-8-6(5)2;/h3-4H,1-2H3;1H |
| InChIKey | URNCDKCSCUZVGB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.61 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |