About 4-fluoropyridin-3-ol;hydrochloride
4-fluoropyridin-3-ol;hydrochloride (PubChem CID 86717938) has the molecular formula C5H5ClFNO
and a molecular weight of 149.55 g/mol. Its IUPAC name is 4-fluoropyridin-3-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-fluoropyridin-3-ol;hydrochloride |
| PubChem CID | 86717938 |
| Molecular Formula | C5H5ClFNO |
| Molecular Weight | 149.55 g/mol |
| Exact Mass | 149.00 |
| IUPAC Name | 4-fluoropyridin-3-ol;hydrochloride |
| SMILES | Cl.Oc1cnccc1F |
| InChI | InChI=1S/C5H4FNO.ClH/c6-4-1-2-7-3-5(4)8;/h1-3,8H;1H |
| InChIKey | MLTPGVMDLARMER-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.55 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoropyridin-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoropyridin-3-ol;hydrochloride?
The IUPAC name of 4-fluoropyridin-3-ol;hydrochloride (CID 86717938) is 4-fluoropyridin-3-ol;hydrochloride.
What is the SMILES notation for 4-fluoropyridin-3-ol;hydrochloride?
The canonical SMILES for 4-fluoropyridin-3-ol;hydrochloride is Cl.Oc1cnccc1F.
What is the InChIKey of 4-fluoropyridin-3-ol;hydrochloride?
The InChIKey is MLTPGVMDLARMER-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4FNO.ClH/c6-4-1-2-7-3-5(4)8;/h1-3,8H;1H.
What are the key properties of 4-fluoropyridin-3-ol;hydrochloride?
4-fluoropyridin-3-ol;hydrochloride has a molecular weight of 149.55 g/mol, XLogP of 1.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoropyridin-3-ol;hydrochloride is sourced from PubChem (CID 86717938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).