C9H13N3 — CID 55293108
3-[(1R)-1-aminobut-3-enyl]pyridin-4-amine (PubChem CID 55293108) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-[(1R)-1-aminobut-3-enyl]pyridin-4-amine.
| Compound Name | 3-[(1R)-1-aminobut-3-enyl]pyridin-4-amine |
|---|---|
| PubChem CID | 55293108 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 3-[(1R)-1-aminobut-3-enyl]pyridin-4-amine |
| SMILES | C=CC[C@@H](N)c1cnccc1N |
| InChI | InChI=1S/C9H13N3/c1-2-3-8(10)7-6-12-5-4-9(7)11/h2,4-6,8H,1,3,10H2,(H2,11,12)/t8-/m1/s1 |
| InChIKey | XZGQRTDGYWZAAH-MRVPVSSYSA-N |
| XLogP | 1.24 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|