C10H17N3O — CID 106815066
3-(1-amino-3-ethoxypropyl)pyridin-4-amine (PubChem CID 106815066) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-(1-amino-3-ethoxypropyl)pyridin-4-amine.
| Compound Name | 3-(1-amino-3-ethoxypropyl)pyridin-4-amine |
|---|---|
| PubChem CID | 106815066 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-(1-amino-3-ethoxypropyl)pyridin-4-amine |
| SMILES | CCOCCC(N)c1cnccc1N |
| InChI | InChI=1S/C10H17N3O/c1-2-14-6-4-10(12)8-7-13-5-3-9(8)11/h3,5,7,10H,2,4,6,12H2,1H3,(H2,11,13) |
| InChIKey | UUNMNDIRKGODSD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|