C10H16N2O2 — CID 65092313
1-(4-amino-3-pyridinyl)-4-methoxybutan-1-ol (PubChem CID 65092313) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-(4-amino-3-pyridinyl)-4-methoxybutan-1-ol.
| Compound Name | 1-(4-amino-3-pyridinyl)-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 65092313 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 1-(4-amino-3-pyridinyl)-4-methoxybutan-1-ol |
| SMILES | COCCCC(O)c1cnccc1N |
| InChI | InChI=1S/C10H16N2O2/c1-14-6-2-3-10(13)8-7-12-5-4-9(8)11/h4-5,7,10,13H,2-3,6H2,1H3,(H2,11,12) |
| InChIKey | ATQHZAKKISOSBP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|